C40H52O4 — CID 145411912
[5-[2-(hydroxymethyl)prop-2-enoxy]-3-[4-[6-(4-pentylphenyl)naphthalen-2-yl]cyclohexyl]pentyl] 2-methylprop-2-enoate (PubChem CID 145411912) has the molecular formula C40H52O4 and a molecular weight of 596.85 g/mol. Its IUPAC name is [5-[2-(hydroxymethyl)prop-2-enoxy]-3-[4-[6-(4-pentylphenyl)naphthalen-2-yl]cyclohexyl]pentyl] 2-methylprop-2-enoate.
| Compound Name | [5-[2-(hydroxymethyl)prop-2-enoxy]-3-[4-[6-(4-pentylphenyl)naphthalen-2-yl]cyclohexyl]pentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145411912 |
| Molecular Formula | C40H52O4 |
| Molecular Weight | 596.85 g/mol |
| Exact Mass | 596.39 |
| IUPAC Name | [5-[2-(hydroxymethyl)prop-2-enoxy]-3-[4-[6-(4-pentylphenyl)naphthalen-2-yl]cyclohexyl]pentyl] 2-methylprop-2-enoate |
| SMILES | C=C(CO)COCCC(CCOC(=O)C(=C)C)C1CCC(c2ccc3cc(-c4ccc(CCCCC)cc4)ccc3c2)CC1 |
| InChI | InChI=1S/C40H52O4/c1-5-6-7-8-31-9-11-33(12-10-31)36-17-19-39-26-37(18-20-38(39)25-36)34-15-13-32(14-16-34)35(21-23-43-28-30(4)27-41)22-24-44-40(42)29(2)3/h9-12,17-20,25-26,32,34-35,41H,2,4-8,13-16,21-24,27-28H2,1,3H3 |
| InChIKey | ZUEHWILRFUABDZ-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.85 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|