C45H68O3 — CID 142282447
1-[4-[(E)-2-[4-(1-methoxy-7-methyloct-7-en-3-yl)cyclohexyl]ethenyl]cyclohexyl]-4-(4-pentylphenyl)benzene;2-methylidenepropane-1,3-diol (PubChem CID 142282447) has the molecular formula C45H68O3 and a molecular weight of 657.04 g/mol. Its IUPAC name is 1-[4-[(E)-2-[4-(1-methoxy-7-methyloct-7-en-3-yl)cyclohexyl]ethenyl]cyclohexyl]-4-(4-pentylphenyl)benzene;2-methylidenepropane-1,3-diol.
| Compound Name | 1-[4-[(E)-2-[4-(1-methoxy-7-methyloct-7-en-3-yl)cyclohexyl]ethenyl]cyclohexyl]-4-(4-pentylphenyl)benzene;2-methylidenepropane-1,3-diol |
|---|---|
| PubChem CID | 142282447 |
| Molecular Formula | C45H68O3 |
| Molecular Weight | 657.04 g/mol |
| Exact Mass | 656.52 |
| IUPAC Name | 1-[4-[(E)-2-[4-(1-methoxy-7-methyloct-7-en-3-yl)cyclohexyl]ethenyl]cyclohexyl]-4-(4-pentylphenyl)benzene;2-methylidenepropane-1,3-diol |
| SMILES | C=C(C)CCCC(CCOC)C1CCC(/C=C/C2CCC(c3ccc(-c4ccc(CCCCC)cc4)cc3)CC2)CC1.C=C(CO)CO |
| InChI | InChI=1S/C41H60O.C4H8O2/c1-5-6-7-10-33-14-20-38(21-15-33)40-26-28-41(29-27-40)39-24-18-35(19-25-39)13-12-34-16-22-37(23-17-34)36(30-31-42-4)11-8-9-32(2)3;1-4(2-5)3-6/h12-15,20-21,26-29,34-37,39H,2,5-11,16-19,22-25,30-31H2,1,3-4H3;5-6H,1-3H2/b13-12+; |
| InChIKey | XFBRSGZVWWGNDZ-UEIGIMKUSA-N |
| XLogP | 11.65 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.04 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|