C37H44O7 — CID 134244453
[3-[2-(hydroxymethyl)prop-2-enoyloxy]-2-[5-[4-(6-pentylnaphthalen-2-yl)phenyl]oxan-2-yl]propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134244453) has the molecular formula C37H44O7 and a molecular weight of 600.75 g/mol. Its IUPAC name is [3-[2-(hydroxymethyl)prop-2-enoyloxy]-2-[5-[4-(6-pentylnaphthalen-2-yl)phenyl]oxan-2-yl]propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [3-[2-(hydroxymethyl)prop-2-enoyloxy]-2-[5-[4-(6-pentylnaphthalen-2-yl)phenyl]oxan-2-yl]propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134244453 |
| Molecular Formula | C37H44O7 |
| Molecular Weight | 600.75 g/mol |
| Exact Mass | 600.31 |
| IUPAC Name | [3-[2-(hydroxymethyl)prop-2-enoyloxy]-2-[5-[4-(6-pentylnaphthalen-2-yl)phenyl]oxan-2-yl]propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(COC(=O)C(=C)CO)C1CCC(c2ccc(-c3ccc4cc(CCCCC)ccc4c3)cc2)CO1 |
| InChI | InChI=1S/C37H44O7/c1-4-5-6-7-27-8-9-32-19-31(15-14-30(32)18-27)28-10-12-29(13-11-28)33-16-17-35(42-22-33)34(23-43-36(40)25(2)20-38)24-44-37(41)26(3)21-39/h8-15,18-19,33-35,38-39H,2-7,16-17,20-24H2,1H3 |
| InChIKey | KFZQCVBHZSITAY-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.75 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|