C38H42O6 — CID 163755739
2-[3-[2-(3-hydroxypropanoyloxy)ethyl]-5-[4-(6-pentylnaphthalen-2-yl)phenyl]phenyl]ethyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 163755739) has the molecular formula C38H42O6 and a molecular weight of 594.75 g/mol. Its IUPAC name is 2-[3-[2-(3-hydroxypropanoyloxy)ethyl]-5-[4-(6-pentylnaphthalen-2-yl)phenyl]phenyl]ethyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 2-[3-[2-(3-hydroxypropanoyloxy)ethyl]-5-[4-(6-pentylnaphthalen-2-yl)phenyl]phenyl]ethyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 163755739 |
| Molecular Formula | C38H42O6 |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | 2-[3-[2-(3-hydroxypropanoyloxy)ethyl]-5-[4-(6-pentylnaphthalen-2-yl)phenyl]phenyl]ethyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCCc1cc(CCOC(=O)CCO)cc(-c2ccc(-c3ccc4cc(CCCCC)ccc4c3)cc2)c1 |
| InChI | InChI=1S/C38H42O6/c1-3-4-5-6-28-7-8-35-25-34(14-13-33(35)22-28)31-9-11-32(12-10-31)36-23-29(16-19-43-37(41)15-18-39)21-30(24-36)17-20-44-38(42)27(2)26-40/h7-14,21-25,39-40H,2-6,15-20,26H2,1H3 |
| InChIKey | LTWLVSNCGIGIKV-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|