C31H42N2O4 — CID 134245630
2-[3-[2-[2-(methylaminomethyl)prop-2-enoyloxy]ethyl]-5-(4-pentylphenyl)phenyl]ethyl 2-(methylaminomethyl)prop-2-enoate (PubChem CID 134245630) has the molecular formula C31H42N2O4 and a molecular weight of 506.69 g/mol. Its IUPAC name is 2-[3-[2-[2-(methylaminomethyl)prop-2-enoyloxy]ethyl]-5-(4-pentylphenyl)phenyl]ethyl 2-(methylaminomethyl)prop-2-enoate.
| Compound Name | 2-[3-[2-[2-(methylaminomethyl)prop-2-enoyloxy]ethyl]-5-(4-pentylphenyl)phenyl]ethyl 2-(methylaminomethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134245630 |
| Molecular Formula | C31H42N2O4 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | 2-[3-[2-[2-(methylaminomethyl)prop-2-enoyloxy]ethyl]-5-(4-pentylphenyl)phenyl]ethyl 2-(methylaminomethyl)prop-2-enoate |
| SMILES | C=C(CNC)C(=O)OCCc1cc(CCOC(=O)C(=C)CNC)cc(-c2ccc(CCCCC)cc2)c1 |
| InChI | InChI=1S/C31H42N2O4/c1-6-7-8-9-25-10-12-28(13-11-25)29-19-26(14-16-36-30(34)23(2)21-32-4)18-27(20-29)15-17-37-31(35)24(3)22-33-5/h10-13,18-20,32-33H,2-3,6-9,14-17,21-22H2,1,4-5H3 |
| InChIKey | RCOGLTWKJBRNCA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|