C33H42O8 — CID 135164101
2-[3-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethyl]-5-[4-(5-pentyl-1,3-dioxan-2-yl)phenyl]phenyl]ethyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 135164101) has the molecular formula C33H42O8 and a molecular weight of 566.69 g/mol. Its IUPAC name is 2-[3-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethyl]-5-[4-(5-pentyl-1,3-dioxan-2-yl)phenyl]phenyl]ethyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 2-[3-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethyl]-5-[4-(5-pentyl-1,3-dioxan-2-yl)phenyl]phenyl]ethyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 135164101 |
| Molecular Formula | C33H42O8 |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | 2-[3-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethyl]-5-[4-(5-pentyl-1,3-dioxan-2-yl)phenyl]phenyl]ethyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCCc1cc(CCOC(=O)C(=C)CO)cc(-c2ccc(C3OCC(CCCCC)CO3)cc2)c1 |
| InChI | InChI=1S/C33H42O8/c1-4-5-6-7-27-21-40-33(41-22-27)29-10-8-28(9-11-29)30-17-25(12-14-38-31(36)23(2)19-34)16-26(18-30)13-15-39-32(37)24(3)20-35/h8-11,16-18,27,33-35H,2-7,12-15,19-22H2,1H3 |
| InChIKey | LDYUFLFXZWPNNX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|