C36H48O8 — CID 146668716
3-[4-[3-(5-hexyl-1,3-dioxan-2-yl)-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]phenyl]propyl 2-(methoxymethyl)prop-2-enoate (PubChem CID 146668716) has the molecular formula C36H48O8 and a molecular weight of 608.77 g/mol. Its IUPAC name is 3-[4-[3-(5-hexyl-1,3-dioxan-2-yl)-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]phenyl]propyl 2-(methoxymethyl)prop-2-enoate.
| Compound Name | 3-[4-[3-(5-hexyl-1,3-dioxan-2-yl)-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]phenyl]propyl 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 146668716 |
| Molecular Formula | C36H48O8 |
| Molecular Weight | 608.77 g/mol |
| Exact Mass | 608.33 |
| IUPAC Name | 3-[4-[3-(5-hexyl-1,3-dioxan-2-yl)-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenyl]phenyl]propyl 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(-c2ccc(CCCOC(=O)C(=C)COC)cc2)cc1C1OCC(CCCCCC)CO1 |
| InChI | InChI=1S/C36H48O8/c1-6-7-8-9-11-29-24-43-36(44-25-29)32-22-31(17-18-33(32)40-20-21-42-34(37)26(2)3)30-15-13-28(14-16-30)12-10-19-41-35(38)27(4)23-39-5/h13-18,22,29,36H,2,4,6-12,19-21,23-25H2,1,3,5H3 |
| InChIKey | OCDVYDDLNLUCTE-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.77 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|