C24H30F2O7 — CID 145217169
3-[2-[2,3-difluoro-4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]-1,3-dioxan-5-yl]propyl 2-methylprop-2-enoate (PubChem CID 145217169) has the molecular formula C24H30F2O7 and a molecular weight of 468.49 g/mol. Its IUPAC name is 3-[2-[2,3-difluoro-4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]-1,3-dioxan-5-yl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-[2,3-difluoro-4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]-1,3-dioxan-5-yl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145217169 |
| Molecular Formula | C24H30F2O7 |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 3-[2-[2,3-difluoro-4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]-1,3-dioxan-5-yl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCOc1ccc(C2OCC(CCCOC(=O)C(=C)C)CO2)c(F)c1F |
| InChI | InChI=1S/C24H30F2O7/c1-15(2)22(27)30-10-5-7-17-13-32-24(33-14-17)18-8-9-19(21(26)20(18)25)29-11-6-12-31-23(28)16(3)4/h8-9,17,24H,1,3,5-7,10-14H2,2,4H3 |
| InChIKey | SBWZBUCWKCDNRF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|