C18H24O5 — CID 145217199
3-[2-(4-methoxyphenyl)-1,3-dioxan-5-yl]propyl 2-methylprop-2-enoate (PubChem CID 145217199) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-[2-(4-methoxyphenyl)-1,3-dioxan-5-yl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-(4-methoxyphenyl)-1,3-dioxan-5-yl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145217199 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 3-[2-(4-methoxyphenyl)-1,3-dioxan-5-yl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC1COC(c2ccc(OC)cc2)OC1 |
| InChI | InChI=1S/C18H24O5/c1-13(2)17(19)21-10-4-5-14-11-22-18(23-12-14)15-6-8-16(20-3)9-7-15/h6-9,14,18H,1,4-5,10-12H2,2-3H3 |
| InChIKey | HMZRXCDWIMQQEH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|