C28H38F2O7 — CID 145217143
6-[5-[2,3-difluoro-4-(6-prop-2-enoyloxyhexoxy)phenyl]-1,3-dioxan-2-yl]hexyl prop-2-enoate (PubChem CID 145217143) has the molecular formula C28H38F2O7 and a molecular weight of 524.60 g/mol. Its IUPAC name is 6-[5-[2,3-difluoro-4-(6-prop-2-enoyloxyhexoxy)phenyl]-1,3-dioxan-2-yl]hexyl prop-2-enoate.
| Compound Name | 6-[5-[2,3-difluoro-4-(6-prop-2-enoyloxyhexoxy)phenyl]-1,3-dioxan-2-yl]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 145217143 |
| Molecular Formula | C28H38F2O7 |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 6-[5-[2,3-difluoro-4-(6-prop-2-enoyloxyhexoxy)phenyl]-1,3-dioxan-2-yl]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C2COC(CCCCCCOC(=O)C=C)OC2)c(F)c1F |
| InChI | InChI=1S/C28H38F2O7/c1-3-24(31)34-17-11-6-5-9-13-26-36-19-21(20-37-26)22-14-15-23(28(30)27(22)29)33-16-10-7-8-12-18-35-25(32)4-2/h3-4,14-15,21,26H,1-2,5-13,16-20H2 |
| InChIKey | ZKLKHLCOEVSZJI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|