C36H40F4O10 — CID 59513030
[2,3-difluoro-4-[4-(6-prop-2-enoyloxyhexoxy)cyclohexyl]phenyl] 2,2-difluoro-7-(4-prop-2-enoyloxybutoxy)-1,3-benzodioxole-4-carboxylate (PubChem CID 59513030) has the molecular formula C36H40F4O10 and a molecular weight of 708.70 g/mol. Its IUPAC name is [2,3-difluoro-4-[4-(6-prop-2-enoyloxyhexoxy)cyclohexyl]phenyl] 2,2-difluoro-7-(4-prop-2-enoyloxybutoxy)-1,3-benzodioxole-4-carboxylate.
| Compound Name | [2,3-difluoro-4-[4-(6-prop-2-enoyloxyhexoxy)cyclohexyl]phenyl] 2,2-difluoro-7-(4-prop-2-enoyloxybutoxy)-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 59513030 |
| Molecular Formula | C36H40F4O10 |
| Molecular Weight | 708.70 g/mol |
| Exact Mass | 708.26 |
| IUPAC Name | [2,3-difluoro-4-[4-(6-prop-2-enoyloxyhexoxy)cyclohexyl]phenyl] 2,2-difluoro-7-(4-prop-2-enoyloxybutoxy)-1,3-benzodioxole-4-carboxylate |
| SMILES | C=CC(=O)OCCCCCCOC1CCC(c2ccc(OC(=O)c3ccc(OCCCCOC(=O)C=C)c4c3OC(F)(F)O4)c(F)c2F)CC1 |
| InChI | InChI=1S/C36H40F4O10/c1-3-29(41)46-21-8-6-5-7-19-44-24-13-11-23(12-14-24)25-15-17-27(32(38)31(25)37)48-35(43)26-16-18-28(34-33(26)49-36(39,40)50-34)45-20-9-10-22-47-30(42)4-2/h3-4,15-18,23-24H,1-2,5-14,19-22H2 |
| InChIKey | WLRDYPKDZWLZST-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.70 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|