C19H28F2O3 — CID 54271131
2,3-difluoro-4-(5-nonyl-1,3-dioxan-2-yl)phenol (PubChem CID 54271131) has the molecular formula C19H28F2O3 and a molecular weight of 342.43 g/mol. Its IUPAC name is 2,3-difluoro-4-(5-nonyl-1,3-dioxan-2-yl)phenol.
| Compound Name | 2,3-difluoro-4-(5-nonyl-1,3-dioxan-2-yl)phenol |
|---|---|
| PubChem CID | 54271131 |
| Molecular Formula | C19H28F2O3 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 2,3-difluoro-4-(5-nonyl-1,3-dioxan-2-yl)phenol |
| SMILES | CCCCCCCCCC1COC(c2ccc(O)c(F)c2F)OC1 |
| InChI | InChI=1S/C19H28F2O3/c1-2-3-4-5-6-7-8-9-14-12-23-19(24-13-14)15-10-11-16(22)18(21)17(15)20/h10-11,14,19,22H,2-9,12-13H2,1H3 |
| InChIKey | RKEZXGPRGQNISH-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|