C16H21F3O2 — CID 54073720
5-pentyl-2-(2,3,5-trifluoro-4-methylphenyl)-1,3-dioxane (PubChem CID 54073720) has the molecular formula C16H21F3O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is 5-pentyl-2-(2,3,5-trifluoro-4-methylphenyl)-1,3-dioxane.
| Compound Name | 5-pentyl-2-(2,3,5-trifluoro-4-methylphenyl)-1,3-dioxane |
|---|---|
| PubChem CID | 54073720 |
| Molecular Formula | C16H21F3O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 5-pentyl-2-(2,3,5-trifluoro-4-methylphenyl)-1,3-dioxane |
| SMILES | CCCCCC1COC(c2cc(F)c(C)c(F)c2F)OC1 |
| InChI | InChI=1S/C16H21F3O2/c1-3-4-5-6-11-8-20-16(21-9-11)12-7-13(17)10(2)14(18)15(12)19/h7,11,16H,3-6,8-9H2,1-2H3 |
| InChIKey | MIGISQKKNSCHDY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|