C26H33F3O2 — CID 160755905
2-[2-[4-(3,5-difluoro-4-methylphenyl)-3-fluorophenyl]ethyl]-5-heptyl-1,3-dioxane (PubChem CID 160755905) has the molecular formula C26H33F3O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-[2-[4-(3,5-difluoro-4-methylphenyl)-3-fluorophenyl]ethyl]-5-heptyl-1,3-dioxane.
| Compound Name | 2-[2-[4-(3,5-difluoro-4-methylphenyl)-3-fluorophenyl]ethyl]-5-heptyl-1,3-dioxane |
|---|---|
| PubChem CID | 160755905 |
| Molecular Formula | C26H33F3O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 2-[2-[4-(3,5-difluoro-4-methylphenyl)-3-fluorophenyl]ethyl]-5-heptyl-1,3-dioxane |
| SMILES | CCCCCCCC1COC(CCc2ccc(-c3cc(F)c(C)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C26H33F3O2/c1-3-4-5-6-7-8-20-16-30-26(31-17-20)12-10-19-9-11-22(25(29)13-19)21-14-23(27)18(2)24(28)15-21/h9,11,13-15,20,26H,3-8,10,12,16-17H2,1-2H3 |
| InChIKey | XSQZMJBRYKGVRX-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|