C17H25ClO2 — CID 20656665
2-[2-(4-chlorophenyl)ethyl]-5-pentyl-1,3-dioxane (PubChem CID 20656665) has the molecular formula C17H25ClO2 and a molecular weight of 296.84 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)ethyl]-5-pentyl-1,3-dioxane.
| Compound Name | 2-[2-(4-chlorophenyl)ethyl]-5-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 20656665 |
| Molecular Formula | C17H25ClO2 |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-[2-(4-chlorophenyl)ethyl]-5-pentyl-1,3-dioxane |
| SMILES | CCCCCC1COC(CCc2ccc(Cl)cc2)OC1 |
| InChI | InChI=1S/C17H25ClO2/c1-2-3-4-5-15-12-19-17(20-13-15)11-8-14-6-9-16(18)10-7-14/h6-7,9-10,15,17H,2-5,8,11-13H2,1H3 |
| InChIKey | IUUKOAYQJFMMLM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|