C21H30ClFO4 — CID 22876825
2-[2-(4-chloro-3-fluorophenyl)ethyl]-5-(5-pentyl-1,3-dioxan-2-yl)-1,3-dioxane (PubChem CID 22876825) has the molecular formula C21H30ClFO4 and a molecular weight of 400.92 g/mol. Its IUPAC name is 2-[2-(4-chloro-3-fluorophenyl)ethyl]-5-(5-pentyl-1,3-dioxan-2-yl)-1,3-dioxane.
| Compound Name | 2-[2-(4-chloro-3-fluorophenyl)ethyl]-5-(5-pentyl-1,3-dioxan-2-yl)-1,3-dioxane |
|---|---|
| PubChem CID | 22876825 |
| Molecular Formula | C21H30ClFO4 |
| Molecular Weight | 400.92 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-[2-(4-chloro-3-fluorophenyl)ethyl]-5-(5-pentyl-1,3-dioxan-2-yl)-1,3-dioxane |
| SMILES | CCCCCC1COC(C2COC(CCc3ccc(Cl)c(F)c3)OC2)OC1 |
| InChI | InChI=1S/C21H30ClFO4/c1-2-3-4-5-16-11-26-21(27-12-16)17-13-24-20(25-14-17)9-7-15-6-8-18(22)19(23)10-15/h6,8,10,16-17,20-21H,2-5,7,9,11-14H2,1H3 |
| InChIKey | WJCRPLVDNKPKAP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.92 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|