C30H32F3NO2 — CID 139871664
2,6-difluoro-4-[2-[1-fluoro-6-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]naphthalen-2-yl]ethyl]benzonitrile (PubChem CID 139871664) has the molecular formula C30H32F3NO2 and a molecular weight of 495.59 g/mol. Its IUPAC name is 2,6-difluoro-4-[2-[1-fluoro-6-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]naphthalen-2-yl]ethyl]benzonitrile.
| Compound Name | 2,6-difluoro-4-[2-[1-fluoro-6-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]naphthalen-2-yl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 139871664 |
| Molecular Formula | C30H32F3NO2 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 2,6-difluoro-4-[2-[1-fluoro-6-[2-(5-pentyl-1,3-dioxan-2-yl)ethyl]naphthalen-2-yl]ethyl]benzonitrile |
| SMILES | CCCCCC1COC(CCc2ccc3c(F)c(CCc4cc(F)c(C#N)c(F)c4)ccc3c2)OC1 |
| InChI | InChI=1S/C30H32F3NO2/c1-2-3-4-5-22-18-35-29(36-19-22)13-8-20-7-12-25-24(14-20)11-10-23(30(25)33)9-6-21-15-27(31)26(17-34)28(32)16-21/h7,10-12,14-16,22,29H,2-6,8-9,13,18-19H2,1H3 |
| InChIKey | JLTFGYCTBFDNBB-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|