C30H32F6O4 — CID 139871802
5-butoxy-2-[2-[6-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-1,3-dioxane (PubChem CID 139871802) has the molecular formula C30H32F6O4 and a molecular weight of 570.57 g/mol. Its IUPAC name is 5-butoxy-2-[2-[6-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-1,3-dioxane.
| Compound Name | 5-butoxy-2-[2-[6-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 139871802 |
| Molecular Formula | C30H32F6O4 |
| Molecular Weight | 570.57 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | 5-butoxy-2-[2-[6-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]ethyl]-1,3-dioxane |
| SMILES | CCCCOC1COC(CCc2ccc3c(F)c(CCc4cc(F)c(OCC(F)(F)F)c(F)c4)ccc3c2)OC1 |
| InChI | InChI=1S/C30H32F6O4/c1-2-3-12-37-23-16-38-27(39-17-23)11-6-19-5-10-24-22(13-19)9-8-21(28(24)33)7-4-20-14-25(31)29(26(32)15-20)40-18-30(34,35)36/h5,8-10,13-15,23,27H,2-4,6-7,11-12,16-18H2,1H3 |
| InChIKey | GYBRLNUWHCAQRT-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.57 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|