C28H28F6O4 — CID 139874580
5-butoxy-2-[6-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]-1,3-dioxane (PubChem CID 139874580) has the molecular formula C28H28F6O4 and a molecular weight of 542.52 g/mol. Its IUPAC name is 5-butoxy-2-[6-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]-1,3-dioxane.
| Compound Name | 5-butoxy-2-[6-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 139874580 |
| Molecular Formula | C28H28F6O4 |
| Molecular Weight | 542.52 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 5-butoxy-2-[6-[2-[3,5-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-5-fluoronaphthalen-2-yl]-1,3-dioxane |
| SMILES | CCCCOC1COC(c2ccc3c(F)c(CCc4cc(F)c(OCC(F)(F)F)c(F)c4)ccc3c2)OC1 |
| InChI | InChI=1S/C28H28F6O4/c1-2-3-10-35-21-14-36-27(37-15-21)20-8-9-22-19(13-20)7-6-18(25(22)31)5-4-17-11-23(29)26(24(30)12-17)38-16-28(32,33)34/h6-9,11-13,21,27H,2-5,10,14-16H2,1H3 |
| InChIKey | BDFJDRWUAYYXPH-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.52 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|