C28H30F4O4 — CID 139874806
2-[6-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-5-fluoronaphthalen-2-yl]-5-pentoxy-1,3-dioxane (PubChem CID 139874806) has the molecular formula C28H30F4O4 and a molecular weight of 506.54 g/mol. Its IUPAC name is 2-[6-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-5-fluoronaphthalen-2-yl]-5-pentoxy-1,3-dioxane.
| Compound Name | 2-[6-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-5-fluoronaphthalen-2-yl]-5-pentoxy-1,3-dioxane |
|---|---|
| PubChem CID | 139874806 |
| Molecular Formula | C28H30F4O4 |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 2-[6-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-5-fluoronaphthalen-2-yl]-5-pentoxy-1,3-dioxane |
| SMILES | CCCCCOC1COC(c2ccc3c(F)c(CCc4ccc(OC(F)F)c(F)c4)ccc3c2)OC1 |
| InChI | InChI=1S/C28H30F4O4/c1-2-3-4-13-33-22-16-34-27(35-17-22)21-10-11-23-20(15-21)9-8-19(26(23)30)7-5-18-6-12-25(24(29)14-18)36-28(31)32/h6,8-12,14-15,22,27-28H,2-5,7,13,16-17H2,1H3 |
| InChIKey | MQBYLCDYNKNQSA-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|