C28H28F4O3 — CID 139874860
2-[6-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-5-fluoronaphthalen-2-yl]-5-[(E)-pent-3-enyl]-1,3-dioxane (PubChem CID 139874860) has the molecular formula C28H28F4O3 and a molecular weight of 488.52 g/mol. Its IUPAC name is 2-[6-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-5-fluoronaphthalen-2-yl]-5-[(E)-pent-3-enyl]-1,3-dioxane.
| Compound Name | 2-[6-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-5-fluoronaphthalen-2-yl]-5-[(E)-pent-3-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 139874860 |
| Molecular Formula | C28H28F4O3 |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 2-[6-[2-[4-(difluoromethoxy)-3-fluorophenyl]ethyl]-5-fluoronaphthalen-2-yl]-5-[(E)-pent-3-enyl]-1,3-dioxane |
| SMILES | C/C=C/CCC1COC(c2ccc3c(F)c(CCc4ccc(OC(F)F)c(F)c4)ccc3c2)OC1 |
| InChI | InChI=1S/C28H28F4O3/c1-2-3-4-5-19-16-33-27(34-17-19)22-11-12-23-21(15-22)10-9-20(26(23)30)8-6-18-7-13-25(24(29)14-18)35-28(31)32/h2-3,7,9-15,19,27-28H,4-6,8,16-17H2,1H3/b3-2+ |
| InChIKey | MEHWEPCBLLRRGE-NSCUHMNNSA-N |
| XLogP | 7.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|