C26H25F3O2 — CID 139873835
5-but-3-enyl-2-[6-[2-(3,4-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-1,3-dioxane (PubChem CID 139873835) has the molecular formula C26H25F3O2 and a molecular weight of 426.48 g/mol. Its IUPAC name is 5-but-3-enyl-2-[6-[2-(3,4-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-1,3-dioxane.
| Compound Name | 5-but-3-enyl-2-[6-[2-(3,4-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-1,3-dioxane |
|---|---|
| PubChem CID | 139873835 |
| Molecular Formula | C26H25F3O2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 5-but-3-enyl-2-[6-[2-(3,4-difluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]-1,3-dioxane |
| SMILES | C=CCCC1COC(c2ccc3c(F)c(CCc4ccc(F)c(F)c4)ccc3c2)OC1 |
| InChI | InChI=1S/C26H25F3O2/c1-2-3-4-18-15-30-26(31-16-18)21-10-11-22-20(14-21)9-8-19(25(22)29)7-5-17-6-12-23(27)24(28)13-17/h2,6,8-14,18,26H,1,3-5,7,15-16H2 |
| InChIKey | PYSYSEYKZLMBCV-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|