C28H29ClF2O2 — CID 139872592
5-but-3-enyl-2-[2-[6-[2-(4-chloro-3-fluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]ethyl]-1,3-dioxane (PubChem CID 139872592) has the molecular formula C28H29ClF2O2 and a molecular weight of 470.99 g/mol. Its IUPAC name is 5-but-3-enyl-2-[2-[6-[2-(4-chloro-3-fluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]ethyl]-1,3-dioxane.
| Compound Name | 5-but-3-enyl-2-[2-[6-[2-(4-chloro-3-fluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 139872592 |
| Molecular Formula | C28H29ClF2O2 |
| Molecular Weight | 470.99 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 5-but-3-enyl-2-[2-[6-[2-(4-chloro-3-fluorophenyl)ethyl]-5-fluoronaphthalen-2-yl]ethyl]-1,3-dioxane |
| SMILES | C=CCCC1COC(CCc2ccc3c(F)c(CCc4ccc(Cl)c(F)c4)ccc3c2)OC1 |
| InChI | InChI=1S/C28H29ClF2O2/c1-2-3-4-21-17-32-27(33-18-21)14-8-19-6-12-24-23(15-19)11-10-22(28(24)31)9-5-20-7-13-25(29)26(30)16-20/h2,6-7,10-13,15-16,21,27H,1,3-5,8-9,14,17-18H2 |
| InChIKey | AXMPEPULYOSUMV-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.99 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|