C26H26F4O2 — CID 139873146
5-ethyl-2-[2-[5-fluoro-6-[2-(3,4,5-trifluorophenyl)ethyl]naphthalen-2-yl]ethyl]-1,3-dioxane (PubChem CID 139873146) has the molecular formula C26H26F4O2 and a molecular weight of 446.48 g/mol. Its IUPAC name is 5-ethyl-2-[2-[5-fluoro-6-[2-(3,4,5-trifluorophenyl)ethyl]naphthalen-2-yl]ethyl]-1,3-dioxane.
| Compound Name | 5-ethyl-2-[2-[5-fluoro-6-[2-(3,4,5-trifluorophenyl)ethyl]naphthalen-2-yl]ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 139873146 |
| Molecular Formula | C26H26F4O2 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 5-ethyl-2-[2-[5-fluoro-6-[2-(3,4,5-trifluorophenyl)ethyl]naphthalen-2-yl]ethyl]-1,3-dioxane |
| SMILES | CCC1COC(CCc2ccc3c(F)c(CCc4cc(F)c(F)c(F)c4)ccc3c2)OC1 |
| InChI | InChI=1S/C26H26F4O2/c1-2-16-14-31-24(32-15-16)10-5-17-4-9-21-20(11-17)8-7-19(25(21)29)6-3-18-12-22(27)26(30)23(28)13-18/h4,7-9,11-13,16,24H,2-3,5-6,10,14-15H2,1H3 |
| InChIKey | MVMCQBAYHIVCGS-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|