C20H21F3O2 — CID 166662193
5-ethyl-2-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]-1,3-dioxane (PubChem CID 166662193) has the molecular formula C20H21F3O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is 5-ethyl-2-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]-1,3-dioxane.
| Compound Name | 5-ethyl-2-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 166662193 |
| Molecular Formula | C20H21F3O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 5-ethyl-2-[2-[4-(3,4,5-trifluorophenyl)phenyl]ethyl]-1,3-dioxane |
| SMILES | CCC1COC(CCc2ccc(-c3cc(F)c(F)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C20H21F3O2/c1-2-13-11-24-19(25-12-13)8-5-14-3-6-15(7-4-14)16-9-17(21)20(23)18(22)10-16/h3-4,6-7,9-10,13,19H,2,5,8,11-12H2,1H3 |
| InChIKey | MFMOBECCTPCVRF-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|