C21H21BrF4O3 — CID 20653777
2-[2-[4-[4-[bromo(difluoro)methyl]-3,5-difluorophenyl]phenyl]ethyl]-5-ethoxy-1,3-dioxane (PubChem CID 20653777) has the molecular formula C21H21BrF4O3 and a molecular weight of 477.29 g/mol. Its IUPAC name is 2-[2-[4-[4-[bromo(difluoro)methyl]-3,5-difluorophenyl]phenyl]ethyl]-5-ethoxy-1,3-dioxane.
| Compound Name | 2-[2-[4-[4-[bromo(difluoro)methyl]-3,5-difluorophenyl]phenyl]ethyl]-5-ethoxy-1,3-dioxane |
|---|---|
| PubChem CID | 20653777 |
| Molecular Formula | C21H21BrF4O3 |
| Molecular Weight | 477.29 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 2-[2-[4-[4-[bromo(difluoro)methyl]-3,5-difluorophenyl]phenyl]ethyl]-5-ethoxy-1,3-dioxane |
| SMILES | CCOC1COC(CCc2ccc(-c3cc(F)c(C(F)(F)Br)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C21H21BrF4O3/c1-2-27-16-11-28-19(29-12-16)8-5-13-3-6-14(7-4-13)15-9-17(23)20(18(24)10-15)21(22,25)26/h3-4,6-7,9-10,16,19H,2,5,8,11-12H2,1H3 |
| InChIKey | YLIHJUDEFYSWEW-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.29 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|