C22H23BrF4O2 — CID 20653778
2-[2-[4-[4-[bromo(difluoro)methyl]-3,5-difluorophenyl]phenyl]ethyl]-5-propyl-1,3-dioxane (PubChem CID 20653778) has the molecular formula C22H23BrF4O2 and a molecular weight of 475.32 g/mol. Its IUPAC name is 2-[2-[4-[4-[bromo(difluoro)methyl]-3,5-difluorophenyl]phenyl]ethyl]-5-propyl-1,3-dioxane.
| Compound Name | 2-[2-[4-[4-[bromo(difluoro)methyl]-3,5-difluorophenyl]phenyl]ethyl]-5-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 20653778 |
| Molecular Formula | C22H23BrF4O2 |
| Molecular Weight | 475.32 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | 2-[2-[4-[4-[bromo(difluoro)methyl]-3,5-difluorophenyl]phenyl]ethyl]-5-propyl-1,3-dioxane |
| SMILES | CCCC1COC(CCc2ccc(-c3cc(F)c(C(F)(F)Br)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C22H23BrF4O2/c1-2-3-15-12-28-20(29-13-15)9-6-14-4-7-16(8-5-14)17-10-18(24)21(19(25)11-17)22(23,26)27/h4-5,7-8,10-11,15,20H,2-3,6,9,12-13H2,1H3 |
| InChIKey | SRHHIVKLFFRUJF-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.32 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|