C17H21F5O3 — CID 20656604
2-[2-[3-fluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-5-propyl-1,3-dioxane (PubChem CID 20656604) has the molecular formula C17H21F5O3 and a molecular weight of 368.34 g/mol. Its IUPAC name is 2-[2-[3-fluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-5-propyl-1,3-dioxane.
| Compound Name | 2-[2-[3-fluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-5-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 20656604 |
| Molecular Formula | C17H21F5O3 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-[2-[3-fluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-5-propyl-1,3-dioxane |
| SMILES | CCCC1COC(CCc2ccc(OC(F)(F)C(F)F)c(F)c2)OC1 |
| InChI | InChI=1S/C17H21F5O3/c1-2-3-12-9-23-15(24-10-12)7-5-11-4-6-14(13(18)8-11)25-17(21,22)16(19)20/h4,6,8,12,15-16H,2-3,5,7,9-10H2,1H3 |
| InChIKey | XLBYQDKHDROKRJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|