C22H27F7O3 — CID 21134568
2-[2-[3-fluoro-4-(1,2,2,3,3,3-hexafluoropropoxy)phenyl]ethyl]-5-(4-methylcyclohexyl)-1,3-dioxane (PubChem CID 21134568) has the molecular formula C22H27F7O3 and a molecular weight of 472.44 g/mol. Its IUPAC name is 2-[2-[3-fluoro-4-(1,2,2,3,3,3-hexafluoropropoxy)phenyl]ethyl]-5-(4-methylcyclohexyl)-1,3-dioxane.
| Compound Name | 2-[2-[3-fluoro-4-(1,2,2,3,3,3-hexafluoropropoxy)phenyl]ethyl]-5-(4-methylcyclohexyl)-1,3-dioxane |
|---|---|
| PubChem CID | 21134568 |
| Molecular Formula | C22H27F7O3 |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 2-[2-[3-fluoro-4-(1,2,2,3,3,3-hexafluoropropoxy)phenyl]ethyl]-5-(4-methylcyclohexyl)-1,3-dioxane |
| SMILES | CC1CCC(C2COC(CCc3ccc(OC(F)C(F)(F)C(F)(F)F)c(F)c3)OC2)CC1 |
| InChI | InChI=1S/C22H27F7O3/c1-13-2-6-15(7-3-13)16-11-30-19(31-12-16)9-5-14-4-8-18(17(23)10-14)32-20(24)21(25,26)22(27,28)29/h4,8,10,13,15-16,19-20H,2-3,5-7,9,11-12H2,1H3 |
| InChIKey | JNUDTUKQINKDBI-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|