C27H31F5O2 — CID 118858981
5-[4-(2,3-difluoro-4-propylphenyl)cyclohexyl]-2-[2-(3,4,5-trifluorophenyl)ethyl]-1,3-dioxane (PubChem CID 118858981) has the molecular formula C27H31F5O2 and a molecular weight of 482.53 g/mol. Its IUPAC name is 5-[4-(2,3-difluoro-4-propylphenyl)cyclohexyl]-2-[2-(3,4,5-trifluorophenyl)ethyl]-1,3-dioxane.
| Compound Name | 5-[4-(2,3-difluoro-4-propylphenyl)cyclohexyl]-2-[2-(3,4,5-trifluorophenyl)ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 118858981 |
| Molecular Formula | C27H31F5O2 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 5-[4-(2,3-difluoro-4-propylphenyl)cyclohexyl]-2-[2-(3,4,5-trifluorophenyl)ethyl]-1,3-dioxane |
| SMILES | CCCc1ccc(C2CCC(C3COC(CCc4cc(F)c(F)c(F)c4)OC3)CC2)c(F)c1F |
| InChI | InChI=1S/C27H31F5O2/c1-2-3-19-9-10-21(26(31)25(19)30)18-7-5-17(6-8-18)20-14-33-24(34-15-20)11-4-16-12-22(28)27(32)23(29)13-16/h9-10,12-13,17-18,20,24H,2-8,11,14-15H2,1H3 |
| InChIKey | APBREQVQJLZSHE-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|