C15H19F3O2 — CID 20656959
5-propyl-2-[2-(3,4,5-trifluorophenyl)ethyl]-1,3-dioxane (PubChem CID 20656959) has the molecular formula C15H19F3O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 5-propyl-2-[2-(3,4,5-trifluorophenyl)ethyl]-1,3-dioxane.
| Compound Name | 5-propyl-2-[2-(3,4,5-trifluorophenyl)ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 20656959 |
| Molecular Formula | C15H19F3O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 5-propyl-2-[2-(3,4,5-trifluorophenyl)ethyl]-1,3-dioxane |
| SMILES | CCCC1COC(CCc2cc(F)c(F)c(F)c2)OC1 |
| InChI | InChI=1S/C15H19F3O2/c1-2-3-11-8-19-14(20-9-11)5-4-10-6-12(16)15(18)13(17)7-10/h6-7,11,14H,2-5,8-9H2,1H3 |
| InChIKey | NXZKSTONIWVRBJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|