C10H20O2 — CID 21043213
2,5-dipropyl-1,3-dioxane (PubChem CID 21043213) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is 2,5-dipropyl-1,3-dioxane.
| Compound Name | 2,5-dipropyl-1,3-dioxane |
|---|---|
| PubChem CID | 21043213 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 2,5-dipropyl-1,3-dioxane |
| SMILES | CCCC1COC(CCC)OC1 |
| InChI | InChI=1S/C10H20O2/c1-3-5-9-7-11-10(6-4-2)12-8-9/h9-10H,3-8H2,1-2H3 |
| InChIKey | YXJVIGQOFPIMNS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |