C14H26O4 — CID 22910604
2-propyl-5-(5-propyl-1,3-dioxan-2-yl)-1,3-dioxane (PubChem CID 22910604) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-propyl-5-(5-propyl-1,3-dioxan-2-yl)-1,3-dioxane.
| Compound Name | 2-propyl-5-(5-propyl-1,3-dioxan-2-yl)-1,3-dioxane |
|---|---|
| PubChem CID | 22910604 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2-propyl-5-(5-propyl-1,3-dioxan-2-yl)-1,3-dioxane |
| SMILES | CCCC1COC(C2COC(CCC)OC2)OC1 |
| InChI | InChI=1S/C14H26O4/c1-3-5-11-7-17-14(18-8-11)12-9-15-13(6-4-2)16-10-12/h11-14H,3-10H2,1-2H3 |
| InChIKey | BZGRKUXBURMLLZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |