C18H31F3O4 — CID 154530749
2,2,2-trifluoro-1-[[4-[2-(5-propyl-1,3-dioxan-2-yl)ethyl]cyclohexyl]methoxy]ethanol (PubChem CID 154530749) has the molecular formula C18H31F3O4 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[[4-[2-(5-propyl-1,3-dioxan-2-yl)ethyl]cyclohexyl]methoxy]ethanol.
| Compound Name | 2,2,2-trifluoro-1-[[4-[2-(5-propyl-1,3-dioxan-2-yl)ethyl]cyclohexyl]methoxy]ethanol |
|---|---|
| PubChem CID | 154530749 |
| Molecular Formula | C18H31F3O4 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 2,2,2-trifluoro-1-[[4-[2-(5-propyl-1,3-dioxan-2-yl)ethyl]cyclohexyl]methoxy]ethanol |
| SMILES | CCCC1COC(CCC2CCC(COC(O)C(F)(F)F)CC2)OC1 |
| InChI | InChI=1S/C18H31F3O4/c1-2-3-15-11-23-16(24-12-15)9-8-13-4-6-14(7-5-13)10-25-17(22)18(19,20)21/h13-17,22H,2-12H2,1H3 |
| InChIKey | KTXQXBXGFUGDJQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|