C20H32F2O4 — CID 20614981
2-[4-[2-(5-but-3-enyl-1,3-dioxan-2-yl)ethyl]cyclohexyl]ethyl 2,2-difluoroacetate (PubChem CID 20614981) has the molecular formula C20H32F2O4 and a molecular weight of 374.47 g/mol. Its IUPAC name is 2-[4-[2-(5-but-3-enyl-1,3-dioxan-2-yl)ethyl]cyclohexyl]ethyl 2,2-difluoroacetate.
| Compound Name | 2-[4-[2-(5-but-3-enyl-1,3-dioxan-2-yl)ethyl]cyclohexyl]ethyl 2,2-difluoroacetate |
|---|---|
| PubChem CID | 20614981 |
| Molecular Formula | C20H32F2O4 |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 2-[4-[2-(5-but-3-enyl-1,3-dioxan-2-yl)ethyl]cyclohexyl]ethyl 2,2-difluoroacetate |
| SMILES | C=CCCC1COC(CCC2CCC(CCOC(=O)C(F)F)CC2)OC1 |
| InChI | InChI=1S/C20H32F2O4/c1-2-3-4-17-13-25-18(26-14-17)10-9-15-5-7-16(8-6-15)11-12-24-20(23)19(21)22/h2,15-19H,1,3-14H2 |
| InChIKey | ZWPRGLKUVPJDHO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|