C17H25F3O2 — CID 89390377
(3,4,5-trifluorocyclohexyl) 4-but-3-enylcyclohexane-1-carboxylate (PubChem CID 89390377) has the molecular formula C17H25F3O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is (3,4,5-trifluorocyclohexyl) 4-but-3-enylcyclohexane-1-carboxylate.
| Compound Name | (3,4,5-trifluorocyclohexyl) 4-but-3-enylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 89390377 |
| Molecular Formula | C17H25F3O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (3,4,5-trifluorocyclohexyl) 4-but-3-enylcyclohexane-1-carboxylate |
| SMILES | C=CCCC1CCC(C(=O)OC2CC(F)C(F)C(F)C2)CC1 |
| InChI | InChI=1S/C17H25F3O2/c1-2-3-4-11-5-7-12(8-6-11)17(21)22-13-9-14(18)16(20)15(19)10-13/h2,11-16H,1,3-10H2 |
| InChIKey | ICIMPNYNIGPNRR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|