About (3,4,5-trifluorocyclohexyl) 4-but-3-enylcyclohexane-1-carboxylate
(3,4,5-trifluorocyclohexyl) 4-but-3-enylcyclohexane-1-carboxylate (PubChem CID 89390377) has the molecular formula C17H25F3O2
and a molecular weight of 318.38 g/mol. Its IUPAC name is (3,4,5-trifluorocyclohexyl) 4-but-3-enylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (3,4,5-trifluorocyclohexyl) 4-but-3-enylcyclohexane-1-carboxylate |
| PubChem CID | 89390377 |
| Molecular Formula | C17H25F3O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (3,4,5-trifluorocyclohexyl) 4-but-3-enylcyclohexane-1-carboxylate |
| SMILES | C=CCCC1CCC(C(=O)OC2CC(F)C(F)C(F)C2)CC1 |
| InChI | InChI=1S/C17H25F3O2/c1-2-3-4-11-5-7-12(8-6-11)17(21)22-13-9-14(18)16(20)15(19)10-13/h2,11-16H,1,3-10H2 |
| InChIKey | ICIMPNYNIGPNRR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3,4,5-trifluorocyclohexyl) 4-but-3-enylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4,5-trifluorocyclohexyl) 4-but-3-enylcyclohexane-1-carboxylate?
The IUPAC name of (3,4,5-trifluorocyclohexyl) 4-but-3-enylcyclohexane-1-carboxylate (CID 89390377) is (3,4,5-trifluorocyclohexyl) 4-but-3-enylcyclohexane-1-carboxylate.
What is the SMILES notation for (3,4,5-trifluorocyclohexyl) 4-but-3-enylcyclohexane-1-carboxylate?
The canonical SMILES for (3,4,5-trifluorocyclohexyl) 4-but-3-enylcyclohexane-1-carboxylate is C=CCCC1CCC(C(=O)OC2CC(F)C(F)C(F)C2)CC1.
What is the InChIKey of (3,4,5-trifluorocyclohexyl) 4-but-3-enylcyclohexane-1-carboxylate?
The InChIKey is ICIMPNYNIGPNRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25F3O2/c1-2-3-4-11-5-7-12(8-6-11)17(21)22-13-9-14(18)16(20)15(19)10-13/h2,11-16H,1,3-10H2.
What are the key properties of (3,4,5-trifluorocyclohexyl) 4-but-3-enylcyclohexane-1-carboxylate?
(3,4,5-trifluorocyclohexyl) 4-but-3-enylcyclohexane-1-carboxylate has a molecular weight of 318.38 g/mol, XLogP of 4.48, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4,5-trifluorocyclohexyl) 4-but-3-enylcyclohexane-1-carboxylate is sourced from PubChem (CID 89390377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).