C15H26F2O2 — CID 59875976
2,2-difluoro-5-[2-(4-propylcyclohexyl)ethyl]-1,3-dioxane (PubChem CID 59875976) has the molecular formula C15H26F2O2 and a molecular weight of 276.37 g/mol. Its IUPAC name is 2,2-difluoro-5-[2-(4-propylcyclohexyl)ethyl]-1,3-dioxane.
| Compound Name | 2,2-difluoro-5-[2-(4-propylcyclohexyl)ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 59875976 |
| Molecular Formula | C15H26F2O2 |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 2,2-difluoro-5-[2-(4-propylcyclohexyl)ethyl]-1,3-dioxane |
| SMILES | CCCC1CCC(CCC2COC(F)(F)OC2)CC1 |
| InChI | InChI=1S/C15H26F2O2/c1-2-3-12-4-6-13(7-5-12)8-9-14-10-18-15(16,17)19-11-14/h12-14H,2-11H2,1H3 |
| InChIKey | QQVNBDYITYSPFO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |