C27H37F5O3 — CID 20656713
2-[4-[3-fluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]cyclohexyl]-5-(4-propylcyclohexyl)-1,3-dioxane (PubChem CID 20656713) has the molecular formula C27H37F5O3 and a molecular weight of 504.58 g/mol. Its IUPAC name is 2-[4-[3-fluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]cyclohexyl]-5-(4-propylcyclohexyl)-1,3-dioxane.
| Compound Name | 2-[4-[3-fluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]cyclohexyl]-5-(4-propylcyclohexyl)-1,3-dioxane |
|---|---|
| PubChem CID | 20656713 |
| Molecular Formula | C27H37F5O3 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 2-[4-[3-fluoro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]cyclohexyl]-5-(4-propylcyclohexyl)-1,3-dioxane |
| SMILES | CCCC1CCC(C2COC(C3CCC(c4ccc(OC(F)(F)C(F)F)c(F)c4)CC3)OC2)CC1 |
| InChI | InChI=1S/C27H37F5O3/c1-2-3-17-4-6-19(7-5-17)22-15-33-25(34-16-22)20-10-8-18(9-11-20)21-12-13-24(23(28)14-21)35-27(31,32)26(29)30/h12-14,17-20,22,25-26H,2-11,15-16H2,1H3 |
| InChIKey | JINSIMTXLUBSHU-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|