C25H35F7O — CID 162134609
2,4-difluoro-1-(1,1,2,2-tetrafluoroethoxy)benzene;1-(2-fluoroethyl)-4-(4-propylcyclohexyl)cyclohexane (PubChem CID 162134609) has the molecular formula C25H35F7O and a molecular weight of 484.54 g/mol. Its IUPAC name is 2,4-difluoro-1-(1,1,2,2-tetrafluoroethoxy)benzene;1-(2-fluoroethyl)-4-(4-propylcyclohexyl)cyclohexane.
| Compound Name | 2,4-difluoro-1-(1,1,2,2-tetrafluoroethoxy)benzene;1-(2-fluoroethyl)-4-(4-propylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 162134609 |
| Molecular Formula | C25H35F7O |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 2,4-difluoro-1-(1,1,2,2-tetrafluoroethoxy)benzene;1-(2-fluoroethyl)-4-(4-propylcyclohexyl)cyclohexane |
| SMILES | CCCC1CCC(C2CCC(CCF)CC2)CC1.Fc1ccc(OC(F)(F)C(F)F)c(F)c1 |
| InChI | InChI=1S/C17H31F.C8H4F6O/c1-2-3-14-4-8-16(9-5-14)17-10-6-15(7-11-17)12-13-18;9-4-1-2-6(5(10)3-4)15-8(13,14)7(11)12/h14-17H,2-13H2,1H3;1-3,7H |
| InChIKey | ZJCKNSZXSBIUID-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|