C23H33FO2 — CID 20726274
[2-fluoro-4-[2-(4-methylcyclohexyl)ethyl]phenyl] 4-methylcyclohexane-1-carboxylate (PubChem CID 20726274) has the molecular formula C23H33FO2 and a molecular weight of 360.51 g/mol. Its IUPAC name is [2-fluoro-4-[2-(4-methylcyclohexyl)ethyl]phenyl] 4-methylcyclohexane-1-carboxylate.
| Compound Name | [2-fluoro-4-[2-(4-methylcyclohexyl)ethyl]phenyl] 4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 20726274 |
| Molecular Formula | C23H33FO2 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | [2-fluoro-4-[2-(4-methylcyclohexyl)ethyl]phenyl] 4-methylcyclohexane-1-carboxylate |
| SMILES | CC1CCC(CCc2ccc(OC(=O)C3CCC(C)CC3)c(F)c2)CC1 |
| InChI | InChI=1S/C23H33FO2/c1-16-3-7-18(8-4-16)9-10-19-11-14-22(21(24)15-19)26-23(25)20-12-5-17(2)6-13-20/h11,14-18,20H,3-10,12-13H2,1-2H3 |
| InChIKey | LSPPCIDTDSDUSG-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|