C32H47FO2 — CID 22085471
[2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl] 4-(4-methylpent-3-enyl)cyclohex-3-ene-1-carboxylate (PubChem CID 22085471) has the molecular formula C32H47FO2 and a molecular weight of 482.72 g/mol. Its IUPAC name is [2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl] 4-(4-methylpent-3-enyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | [2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl] 4-(4-methylpent-3-enyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 22085471 |
| Molecular Formula | C32H47FO2 |
| Molecular Weight | 482.72 g/mol |
| Exact Mass | 482.36 |
| IUPAC Name | [2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl] 4-(4-methylpent-3-enyl)cyclohex-3-ene-1-carboxylate |
| SMILES | CCCCCC1CCC(CCc2ccc(OC(=O)C3CC=C(CCC=C(C)C)CC3)c(F)c2)CC1 |
| InChI | InChI=1S/C32H47FO2/c1-4-5-6-9-25-11-13-27(14-12-25)15-16-28-19-22-31(30(33)23-28)35-32(34)29-20-17-26(18-21-29)10-7-8-24(2)3/h8,17,19,22-23,25,27,29H,4-7,9-16,18,20-21H2,1-3H3 |
| InChIKey | GNKMKKCDYOKSDZ-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.72 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|