C34H53FO2 — CID 54337985
[4-[2-(4-butylcyclohexyl)ethyl]-2-fluorophenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate (PubChem CID 54337985) has the molecular formula C34H53FO2 and a molecular weight of 512.79 g/mol. Its IUPAC name is [4-[2-(4-butylcyclohexyl)ethyl]-2-fluorophenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate.
| Compound Name | [4-[2-(4-butylcyclohexyl)ethyl]-2-fluorophenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54337985 |
| Molecular Formula | C34H53FO2 |
| Molecular Weight | 512.79 g/mol |
| Exact Mass | 512.40 |
| IUPAC Name | [4-[2-(4-butylcyclohexyl)ethyl]-2-fluorophenyl] 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(CCc2ccc(OC(=O)C3CCC(C4CCC(CCC)CC4)CC3)c(F)c2)CC1 |
| InChI | InChI=1S/C34H53FO2/c1-3-5-7-26-8-10-27(11-9-26)12-13-28-16-23-33(32(35)24-28)37-34(36)31-21-19-30(20-22-31)29-17-14-25(6-4-2)15-18-29/h16,23-27,29-31H,3-15,17-22H2,1-2H3 |
| InChIKey | TWWQFXJTQNVRGG-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.79 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|