C24H24F14O2 — CID 18649979
(2-fluoro-4-pentylphenyl) 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclohexane-1-carboxylate (PubChem CID 18649979) has the molecular formula C24H24F14O2 and a molecular weight of 610.43 g/mol. Its IUPAC name is (2-fluoro-4-pentylphenyl) 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclohexane-1-carboxylate.
| Compound Name | (2-fluoro-4-pentylphenyl) 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18649979 |
| Molecular Formula | C24H24F14O2 |
| Molecular Weight | 610.43 g/mol |
| Exact Mass | 610.16 |
| IUPAC Name | (2-fluoro-4-pentylphenyl) 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCc1ccc(OC(=O)C2CCC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC2)c(F)c1 |
| InChI | InChI=1S/C24H24F14O2/c1-2-3-4-5-13-6-11-17(16(25)12-13)40-18(39)14-7-9-15(10-8-14)19(26,27)20(28,29)21(30,31)22(32,33)23(34,35)24(36,37)38/h6,11-12,14-15H,2-5,7-10H2,1H3 |
| InChIKey | MWXQOHKSQAIAQD-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.43 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|