C31H27F19N2O2 — CID 18650002
[4-(5-pentylpyrimidin-2-yl)phenyl] 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononyl)cyclohexane-1-carboxylate (PubChem CID 18650002) has the molecular formula C31H27F19N2O2 and a molecular weight of 820.53 g/mol. Its IUPAC name is [4-(5-pentylpyrimidin-2-yl)phenyl] 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononyl)cyclohexane-1-carboxylate.
| Compound Name | [4-(5-pentylpyrimidin-2-yl)phenyl] 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 18650002 |
| Molecular Formula | C31H27F19N2O2 |
| Molecular Weight | 820.53 g/mol |
| Exact Mass | 820.18 |
| IUPAC Name | [4-(5-pentylpyrimidin-2-yl)phenyl] 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCc1cnc(-c2ccc(OC(=O)C3CCC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC3)cc2)nc1 |
| InChI | InChI=1S/C31H27F19N2O2/c1-2-3-4-5-16-14-51-21(52-15-16)17-8-12-20(13-9-17)54-22(53)18-6-10-19(11-7-18)23(32,33)24(34,35)25(36,37)26(38,39)27(40,41)28(42,43)29(44,45)30(46,47)31(48,49)50/h8-9,12-15,18-19H,2-7,10-11H2,1H3 |
| InChIKey | TWQLANGAXMSMKD-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.53 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|