C27H30N2O3 — CID 59933315
[4-[4-(5-hexylpyrimidin-2-yl)phenyl]phenyl] oxolane-2-carboxylate (PubChem CID 59933315) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is [4-[4-(5-hexylpyrimidin-2-yl)phenyl]phenyl] oxolane-2-carboxylate.
| Compound Name | [4-[4-(5-hexylpyrimidin-2-yl)phenyl]phenyl] oxolane-2-carboxylate |
|---|---|
| PubChem CID | 59933315 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | [4-[4-(5-hexylpyrimidin-2-yl)phenyl]phenyl] oxolane-2-carboxylate |
| SMILES | CCCCCCc1cnc(-c2ccc(-c3ccc(OC(=O)C4CCCO4)cc3)cc2)nc1 |
| InChI | InChI=1S/C27H30N2O3/c1-2-3-4-5-7-20-18-28-26(29-19-20)23-11-9-21(10-12-23)22-13-15-24(16-14-22)32-27(30)25-8-6-17-31-25/h9-16,18-19,25H,2-8,17H2,1H3 |
| InChIKey | UAVGWHHJIMSRHV-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|