C26H31NO3S — CID 139640932
[4-(6-octyl-1,3-benzothiazol-2-yl)phenyl] oxolane-2-carboxylate (PubChem CID 139640932) has the molecular formula C26H31NO3S and a molecular weight of 437.61 g/mol. Its IUPAC name is [4-(6-octyl-1,3-benzothiazol-2-yl)phenyl] oxolane-2-carboxylate.
| Compound Name | [4-(6-octyl-1,3-benzothiazol-2-yl)phenyl] oxolane-2-carboxylate |
|---|---|
| PubChem CID | 139640932 |
| Molecular Formula | C26H31NO3S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | [4-(6-octyl-1,3-benzothiazol-2-yl)phenyl] oxolane-2-carboxylate |
| SMILES | CCCCCCCCc1ccc2nc(-c3ccc(OC(=O)C4CCCO4)cc3)sc2c1 |
| InChI | InChI=1S/C26H31NO3S/c1-2-3-4-5-6-7-9-19-11-16-22-24(18-19)31-25(27-22)20-12-14-21(15-13-20)30-26(28)23-10-8-17-29-23/h11-16,18,23H,2-10,17H2,1H3 |
| InChIKey | MHYUKSPZHFNMOD-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|