C22H28N2O3 — CID 54484152
[4-(5-octylpyrimidin-2-yl)phenyl] (2R,3R)-3-methyloxirane-2-carboxylate (PubChem CID 54484152) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is [4-(5-octylpyrimidin-2-yl)phenyl] (2R,3R)-3-methyloxirane-2-carboxylate.
| Compound Name | [4-(5-octylpyrimidin-2-yl)phenyl] (2R,3R)-3-methyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 54484152 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | [4-(5-octylpyrimidin-2-yl)phenyl] (2R,3R)-3-methyloxirane-2-carboxylate |
| SMILES | CCCCCCCCc1cnc(-c2ccc(OC(=O)[C@@H]3O[C@@H]3C)cc2)nc1 |
| InChI | InChI=1S/C22H28N2O3/c1-3-4-5-6-7-8-9-17-14-23-21(24-15-17)18-10-12-19(13-11-18)27-22(25)20-16(2)26-20/h10-16,20H,3-9H2,1-2H3/t16-,20-/m1/s1 |
| InChIKey | XRCMBHOGOXQJDY-OXQOHEQNSA-N |
| XLogP | 4.74 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|