C24H32N2O3 — CID 139647567
[4-(5-octylpyrimidin-2-yl)phenyl] (2R,3R)-3-propyloxirane-2-carboxylate (PubChem CID 139647567) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is [4-(5-octylpyrimidin-2-yl)phenyl] (2R,3R)-3-propyloxirane-2-carboxylate.
| Compound Name | [4-(5-octylpyrimidin-2-yl)phenyl] (2R,3R)-3-propyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 139647567 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | [4-(5-octylpyrimidin-2-yl)phenyl] (2R,3R)-3-propyloxirane-2-carboxylate |
| SMILES | CCCCCCCCc1cnc(-c2ccc(OC(=O)[C@@H]3O[C@@H]3CCC)cc2)nc1 |
| InChI | InChI=1S/C24H32N2O3/c1-3-5-6-7-8-9-11-18-16-25-23(26-17-18)19-12-14-20(15-13-19)28-24(27)22-21(29-22)10-4-2/h12-17,21-22H,3-11H2,1-2H3/t21-,22-/m1/s1 |
| InChIKey | XQWLXQZEXJGAFV-FGZHOGPDSA-N |
| XLogP | 5.52 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|