C28H38N2O2 — CID 19734031
[4-(5-decylpyrimidin-2-yl)phenyl] 4-methylcyclohex-3-ene-1-carboxylate (PubChem CID 19734031) has the molecular formula C28H38N2O2 and a molecular weight of 434.62 g/mol. Its IUPAC name is [4-(5-decylpyrimidin-2-yl)phenyl] 4-methylcyclohex-3-ene-1-carboxylate.
| Compound Name | [4-(5-decylpyrimidin-2-yl)phenyl] 4-methylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 19734031 |
| Molecular Formula | C28H38N2O2 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | [4-(5-decylpyrimidin-2-yl)phenyl] 4-methylcyclohex-3-ene-1-carboxylate |
| SMILES | CCCCCCCCCCc1cnc(-c2ccc(OC(=O)C3CC=C(C)CC3)cc2)nc1 |
| InChI | InChI=1S/C28H38N2O2/c1-3-4-5-6-7-8-9-10-11-23-20-29-27(30-21-23)24-16-18-26(19-17-24)32-28(31)25-14-12-22(2)13-15-25/h12,16-21,25H,3-11,13-15H2,1-2H3 |
| InChIKey | SRESPOKYKFDRGU-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|