C28H38N2O3 — CID 19734038
[4-(5-decoxypyrimidin-2-yl)phenyl] 4-methylcyclohex-3-ene-1-carboxylate (PubChem CID 19734038) has the molecular formula C28H38N2O3 and a molecular weight of 450.62 g/mol. Its IUPAC name is [4-(5-decoxypyrimidin-2-yl)phenyl] 4-methylcyclohex-3-ene-1-carboxylate.
| Compound Name | [4-(5-decoxypyrimidin-2-yl)phenyl] 4-methylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 19734038 |
| Molecular Formula | C28H38N2O3 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | [4-(5-decoxypyrimidin-2-yl)phenyl] 4-methylcyclohex-3-ene-1-carboxylate |
| SMILES | CCCCCCCCCCOc1cnc(-c2ccc(OC(=O)C3CC=C(C)CC3)cc2)nc1 |
| InChI | InChI=1S/C28H38N2O3/c1-3-4-5-6-7-8-9-10-19-32-26-20-29-27(30-21-26)23-15-17-25(18-16-23)33-28(31)24-13-11-22(2)12-14-24/h11,15-18,20-21,24H,3-10,12-14,19H2,1-2H3 |
| InChIKey | SCKVWEJZFOVNQW-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|